Registration Dossier

Diss Factsheets

IUPAC name:
2-chloro-4-mesyl-3-[(2,2,2-trifluoro-ethoxy)methyl] benzoyl chloride

Inventory

CAS number:
1118729-23-9

Synonyms

Molecular and structural information

Molecular formula:
C11 H9 Cl2 F3 O4 S
Molecular weight:
ca. 365.15
SMILES notation:
CS(=O)(=O)c1ccc(C(=O)Cl)c(Cl)c1COCC(F)(F)F
Structural formula:
Chemical structure

Related substances