Registration Dossier

Diss Factsheets

IUPAC name:
(4aR,4bS,6aS,7S,7aS,8aS,8bS,8cR)-4a,6a-dimethyl-4,4a,4b,6,6a,7a,8,8a,8b,8c-decahydro-3H,3'H-spiro[cyclopropa[4,5]cyclopenta[1,2-a]phenanthrene-7,2'-furan]-2,5(4H,5H)-dione

Inventory

CAS number:
67372-69-4

Synonyms

Molecular and structural information

Molecular formula:
C23H28O3
Molecular weight:
352.467
SMILES notation:
C[C@]12CCC(=O)C=C1C=C[C@@H]3[C@@H]2CC[C@@]4(C)[C@H]3[C@@H]5C[C@@H]5[C@@]46CCC(=O)O6
Structural formula:
Chemical structure

Related substances