Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
9-oxo-9H-thioxanthene-4-carboxylic acid

Inventory

CAS number:
51762-56-2
Synonyms
Names:
10-oxo-10H-dibenzo[b,e]thiopyran-4-carboxylic acid

Molecular and structural information

Molecular formula:
C14H8O3S
Molecular weight:
256.28
SMILES notation:
C1=CC=C2C(=C1)C(=O)C3=C(S2)C(=CC=C3)C(=O)O
InChl:
InChI=1S/C14H8O3S/c15-12-8-4-1-2-7-11(8)18-13-9(12)5-3-6-10(13)14(16)17/h1-7H,(H,16,17)
Structural formula:
Chemical structure

Related substances