Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
tetrabutylthioperoxydicarbamic acid

Inventory

EC number:
216-652-6
EC name:
Tetrabutylthioperoxydicarbamic acid
CAS number:
1634-02-2
CAS number:
1634-02-2
Synonyms
Names:
Disulfide, bis(dibutylthiocarbamoyl)
Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), tetrabutyl-
1,1',1'',1'''-[disulfanediylbis(carbonothioylnitrilo)]tetrabutane

Molecular and structural information

Molecular formula:
C18H36N2S4
Molecular weight:
408.752
SMILES notation:
CCCCN(CCCC)C(=S)SSC(=S)N(CCCC)CCCC
InChl:
InChI=1/C18H36N2S4/c1-5-9-13-19(14-10-6-2)17(21)23-24-18(22)20(15-11-7-3)16-12-8-4/h5-16H2,1-4H3
Structural formula:
Chemical structure

Related substances