Registration Dossier

Diss Factsheets

IUPAC name:
1,3-bis(ethenylsulfonyl)propan-2-ol

Inventory

CAS number:
67006-32-0

Synonyms

Molecular and structural information

Molecular formula:
C7H12O5S2
Molecular weight:
240.288
SMILES notation:
C=CS(=O)(=O)CC(CS(=O)(=O)C=C)O
Structural formula:
Chemical structure

Related substances