Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
1-(3-chlorophenyl)-4-(3-chloropropyl)piperazin-1-ium chloride

Inventory

EC number:
258-038-0
EC name:
1-(3-chlorophenyl)-4-(3-chloropropyl)piperazinium chloride
CAS number:
52605-52-4
CAS number:
52605-52-4
Synonyms
Names:
Identifier:
other: Molecular formula
C13H19Cl3N2
1-(3-chlorophenyl)-4-(3-chloropropyl)piperazin-1-ium chloride

Molecular and structural information

Molecular formula:
C13H18Cl2N2.ClH
Molecular weight:
309.662
SMILES notation:
[Cl-].ClCCCN1CC[NH+](CC1)c2cccc(Cl)c2
InChl:
InChI=1/C13H18Cl2N2.ClH/c14-5-2-6-16-7-9-17(10-8-16)13-4-1-3-12(15)11-13;/h1,3-4,11H,2,5-10H2;1H
Structural formula:
Chemical structure

Related substances